CAS 6304-89-8 appears in our catalog under these names: 3-Acetoxybenzoic acid, 98%, 3-Acetoxybenzoic acid, 3-Acetoxybenzoic acid 98%, 3-Acetoxybenzoic acid, 98%, 98%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 100g, 1g, 500g, 5g, 25g, 50g, 250g, 10g.
3-acetyloxybenzoic acid (CAS 6304-89-8) is a chemical compound with the molecular formula C9H8O4 and a molecular weight of 180.16 g/mol. IUPAC name: 3-acetyloxybenzoic acid. InChIKey: NGMYCWFGNSXLMP-UHFFFAOYSA-N.
| Molecular formula | C9H8O4 |
|---|---|
| Molecular weight | 180.16 g/mol |
| IUPAC name | 3-acetyloxybenzoic acid |
| InChIKey | NGMYCWFGNSXLMP-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=CC=CC(=C1)C(=O)O |
Computed by PubChem (NCBI)