Products 6322-83-4
CAS 6322-83-4 appears in our catalog under these names: 2–(4–Benzoylphenoxy)acetic acid, 2-(4-Benzoylphenoxy)acetic acid, (4-Benzoyl-phenoxy)-acetic acid, 98%, 2-(4-Benzoylphenoxy)acetic acid, 97%, 2-(4-Benzoylphenoxy)acetic acid 95%. Offered by: GLPBio, Biosynth, Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 1g, 5g, 10g, 25g, 250mg, 100mg.
2-(4-benzoylphenoxy)acetic acid (CAS 6322-83-4) is a chemical compound with the molecular formula C15H12O4 and a molecular weight of 256.25 g/mol. IUPAC name: 2-(4-benzoylphenoxy)acetic acid. InChIKey: FQPOVZIKEBLFNG-UHFFFAOYSA-N.
| Molecular formula | C15H12O4 |
|---|---|
| Molecular weight | 256.25 g/mol |
| IUPAC name | 2-(4-benzoylphenoxy)acetic acid |
| InChIKey | FQPOVZIKEBLFNG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C2=CC=C(C=C2)OCC(=O)O |
Computed by PubChem (NCBI)