CAS 63344-48-9 appears in our catalog under these names: [1,1':3',1''-Terphenyl]-4'-amine, >98.0%(HPLC)(T), [1,1':3',1''-Terphenyl]-4'-amine, 98%, 98%, [1,1':3',1''-TERPHENYL]-4'-AMINE, 98%. Offered by: TCI, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg.
2,4-diphenylaniline (CAS 63344-48-9) is a chemical compound with the molecular formula C18H15N and a molecular weight of 245.3 g/mol. IUPAC name: 2,4-diphenylaniline. InChIKey: JZKJBFCCYSJAQX-UHFFFAOYSA-N.
| Molecular formula | C18H15N |
|---|---|
| Molecular weight | 245.3 g/mol |
| IUPAC name | 2,4-diphenylaniline |
| InChIKey | JZKJBFCCYSJAQX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=C(C=C2)N)C3=CC=CC=C3 |
Computed by PubChem (NCBI)