Products 634151-25-0
CAS 634151-25-0 appears in our catalog under these names: 1-(Chloromethyl)-3-fluoro-5-(trifluoromethyl)benzene, 97%, 3–fluoro–5–trifluoromethylbenzyl chloride. Offered by: AmBeed, GLPBio. Available pack sizes: 1g, 5g, 100mg, 250mg.
1-(chloromethyl)-3-fluoro-5-(trifluoromethyl)benzene (CAS 634151-25-0) is a chemical compound with the molecular formula C8H5ClF4 and a molecular weight of 212.57 g/mol. IUPAC name: 1-(chloromethyl)-3-fluoro-5-(trifluoromethyl)benzene. InChIKey: UNZBMTCZGLEHHO-UHFFFAOYSA-N.
| Molecular formula | C8H5ClF4 |
|---|---|
| Molecular weight | 212.57 g/mol |
| IUPAC name | 1-(chloromethyl)-3-fluoro-5-(trifluoromethyl)benzene |
| InChIKey | UNZBMTCZGLEHHO-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1C(F)(F)F)F)CCl |
Computed by PubChem (NCBI)