CAS 63463-27-4 appears in our catalog under these names: 4,7-Dihydroxyquinoline-3-carboxylic acid hydrobromide, 4,7-Dihydroxyquinoline-3-carboxylic acid, 4,7-Dihydroxyquinoline-3-carboxylic acid 95+%, 4,7-Dihydroxyquinoline-3-carboxylic acid, 95+%, 95+%. Offered by: Biosynth, Ambeed, Chemat. Available pack sizes: 0,25g, 0,1g, 5000mg, 1000mg, 0,5g, 1g, 2g, 50mg.
7-hydroxy-4-oxo-1H-quinoline-3-carboxylic acid (CAS 63463-27-4) is a chemical compound with the molecular formula C10H7NO4 and a molecular weight of 205.17 g/mol. IUPAC name: 7-hydroxy-4-oxo-1H-quinoline-3-carboxylic acid. InChIKey: KSGSZGACXQALEU-UHFFFAOYSA-N.
| Molecular formula | C10H7NO4 |
|---|---|
| Molecular weight | 205.17 g/mol |
| IUPAC name | 7-hydroxy-4-oxo-1H-quinoline-3-carboxylic acid |
| InChIKey | KSGSZGACXQALEU-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1O)NC=C(C2=O)C(=O)O |
Computed by PubChem (NCBI)