Products 636-01-1
CAS 636-01-1 is the registry number for 2,5-Dihydroxycinnamic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
(E)-3-(2,5-dihydroxyphenyl)prop-2-enoic acid (CAS 636-01-1) is a chemical compound with the molecular formula C9H8O4 and a molecular weight of 180.16 g/mol. IUPAC name: (E)-3-(2,5-dihydroxyphenyl)prop-2-enoic acid. InChIKey: JXIPYOZBOMUUCA-DAFODLJHSA-N.
| Molecular formula | C9H8O4 |
|---|---|
| Molecular weight | 180.16 g/mol |
| IUPAC name | (E)-3-(2,5-dihydroxyphenyl)prop-2-enoic acid |
| InChIKey | JXIPYOZBOMUUCA-DAFODLJHSA-N |
| SMILES | C1=CC(=C(C=C1O)/C=C/C(=O)O)O |
Computed by PubChem (NCBI)
Synonyms:
2,5-Dihydroxycinnamic acid, (E)-3-(2,5-Dihydroxyphenyl)acrylic acid, (2E)-3-(2,5-Dihydroxyphenyl)acrylic acid, 3-(2,5-dihydroxyphenyl)acrylic acid, (E)-3-(2,5-dihydroxyphenyl)prop-2-enoic Acid, grevillic acid, 3-(2,5-dihydroxyphenyl)prop-2-enoic acid, (e)-2,5-dihydroxycinnamic acid, (2E)-3-(2,5-dihydroxyphenyl)prop-2-enoic acid, 2,5-Dihydroxyzimtsaure