Products 63856-06-4
CAS 63856-06-4 is the registry number for (S)-Methyl 2-amino-2-(thiophen-2-yl)acetate hydrochloride, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Methyl (2S)-2-amino-2-thiophen-2-ylacetate;hydrochloride (CAS 63856-06-4) is a chemical compound with the molecular formula C7H10ClNO2S and a molecular weight of 207.68 g/mol. IUPAC name: methyl (2S)-2-amino-2-thiophen-2-ylacetate;hydrochloride. InChIKey: NZEQIXANVTXFEP-FYZOBXCZSA-N.
| Molecular formula | C7H10ClNO2S |
|---|---|
| Molecular weight | 207.68 g/mol |
| IUPAC name | methyl (2S)-2-amino-2-thiophen-2-ylacetate;hydrochloride |
| InChIKey | NZEQIXANVTXFEP-FYZOBXCZSA-N |
| SMILES | COC(=O)[C@@H](C1=CC=CS1)N.Cl |
Computed by PubChem (NCBI)