CAS 64122-23-2 appears in our catalog under these names: Methyl 3,5–dichloro–2–methoxybenzoate, Methyl 3,5-dichloro-2-methoxybenzoate 95%, METHYL 3,5-DICHLORO-2-METHOXYBENZOATE, 98%, Methyl 3,5-dichloro-2-methoxybenzoate, 98%, 98%. Offered by: GLPBio, Ambeed, Fluorochem, Chemat. Available pack sizes: 1g, 250mg, 5g, 100mg, 25g.
Methyl 3,5-dichloro-2-methoxybenzoate (CAS 64122-23-2) is a chemical compound with the molecular formula C9H8Cl2O3 and a molecular weight of 235.06 g/mol. IUPAC name: methyl 3,5-dichloro-2-methoxybenzoate. InChIKey: WYTVRNKHBROSCB-UHFFFAOYSA-N.
| Molecular formula | C9H8Cl2O3 |
|---|---|
| Molecular weight | 235.06 g/mol |
| IUPAC name | methyl 3,5-dichloro-2-methoxybenzoate |
| InChIKey | WYTVRNKHBROSCB-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1Cl)Cl)C(=O)OC |
Computed by PubChem (NCBI)