Products 65051-17-4
CAS 65051-17-4 appears in our catalog under these names: 2-((3,4-Dichlorophenyl)amino)acetic acid, 98%, 2-((3,4-Dichlorophenyl)amino)acetic acid, 98%, 98%, N-(3,4-dichlorophenyl)glycine, 98%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 100mg, 250mg, 500mg.
2-(3,4-dichloroanilino)acetic acid (CAS 65051-17-4) is a chemical compound with the molecular formula C8H7Cl2NO2 and a molecular weight of 220.05 g/mol. IUPAC name: 2-(3,4-dichloroanilino)acetic acid. InChIKey: BBWWOXQXCLAUKG-UHFFFAOYSA-N.
| Molecular formula | C8H7Cl2NO2 |
|---|---|
| Molecular weight | 220.05 g/mol |
| IUPAC name | 2-(3,4-dichloroanilino)acetic acid |
| InChIKey | BBWWOXQXCLAUKG-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1NCC(=O)O)Cl)Cl |
Computed by PubChem (NCBI)
Synonyms:
N-(3,4-dichlorophenyl)glycine, 2-(3,4-dichloroanilino)acetic acid, (3,4-Dichlorophenyl)glycine, 2-((3,4-Dichlorophenyl)amino)acetic acid, (3,4-Dichloroanilino)-acetic acid, 2-[(3,4-dichlorophenyl)amino]acetic acid, Glycine,n-(3,4-dichlorophenyl)-, Glycine, N-(3,4-dichlorophenyl)-, 3,4-dichloroanilinoacetic acid, BBWWOXQXCLAUKG-UHFFFAOYSA-N