CAS 653-13-4 appears in our catalog under these names: 1-(2-Chlorophenyl)-2,2-difluoroethan-1-one, 98%, 1-(2-Chlorophenyl)-2,2-difluoroethan-1-one, 98%, 98%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 50mg, 100mg, 250mg, 500mg, 2.5g.
1-(2-chlorophenyl)-2,2-difluoroethanone (CAS 653-13-4) is a chemical compound with the molecular formula C8H5ClF2O and a molecular weight of 190.57 g/mol. IUPAC name: 1-(2-chlorophenyl)-2,2-difluoroethanone. InChIKey: LKUYWXJFPNOAFZ-UHFFFAOYSA-N.
| Molecular formula | C8H5ClF2O |
|---|---|
| Molecular weight | 190.57 g/mol |
| IUPAC name | 1-(2-chlorophenyl)-2,2-difluoroethanone |
| InChIKey | LKUYWXJFPNOAFZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)C(F)F)Cl |
Computed by PubChem (NCBI)