CAS 655-76-5 is the registry number for Quinaldinesulfate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-methylquinoline;sulfuric acid (CAS 655-76-5) is a chemical compound with the molecular formula C10H11NO4S and a molecular weight of 241.27 g/mol. IUPAC name: 2-methylquinoline;sulfuric acid. InChIKey: CMBPXXNFXHKRBG-UHFFFAOYSA-N.
| Molecular formula | C10H11NO4S |
|---|---|
| Molecular weight | 241.27 g/mol |
| IUPAC name | 2-methylquinoline;sulfuric acid |
| InChIKey | CMBPXXNFXHKRBG-UHFFFAOYSA-N |
| SMILES | CC1=NC2=CC=CC=C2C=C1.OS(=O)(=O)O |
Computed by PubChem (NCBI)