CAS 657424-77-6 is the registry number for Ethyl 5-(3-chlorophenyl)isoxazole-3-carboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
Ethyl 5-(3-chlorophenyl)-1,2-oxazole-3-carboxylate (CAS 657424-77-6) is a chemical compound with the molecular formula C12H10ClNO3 and a molecular weight of 251.66 g/mol. IUPAC name: ethyl 5-(3-chlorophenyl)-1,2-oxazole-3-carboxylate. InChIKey: ISTFXVOSPPRVQD-UHFFFAOYSA-N.
| Molecular formula | C12H10ClNO3 |
|---|---|
| Molecular weight | 251.66 g/mol |
| IUPAC name | ethyl 5-(3-chlorophenyl)-1,2-oxazole-3-carboxylate |
| InChIKey | ISTFXVOSPPRVQD-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NOC(=C1)C2=CC(=CC=C2)Cl |
Computed by PubChem (NCBI)