Products 65840-95-1
CAS 65840-95-1 is the registry number for Mycobactin-IN-1, 98.96%. Offered by: MedChemExpress. Available pack sizes: 10mM/1mL, 10 mg, 100 mg, 25 mg, 50 mg.
2-[5-(4-chlorophenyl)-4,5-dihydro-1H-pyrazol-3-yl]phenol (CAS 65840-95-1) is a chemical compound with the molecular formula C15H13ClN2O and a molecular weight of 272.73 g/mol. IUPAC name: 2-[5-(4-chlorophenyl)-4,5-dihydro-1H-pyrazol-3-yl]phenol. InChIKey: BMOZIGVHPNPVGU-UHFFFAOYSA-N.
| Molecular formula | C15H13ClN2O |
|---|---|
| Molecular weight | 272.73 g/mol |
| IUPAC name | 2-[5-(4-chlorophenyl)-4,5-dihydro-1H-pyrazol-3-yl]phenol |
| InChIKey | BMOZIGVHPNPVGU-UHFFFAOYSA-N |
| SMILES | C1C(NN=C1C2=CC=CC=C2O)C3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)