CAS 66411-24-3 appears in our catalog under these names: 8-Chloro-2,3-dihydro-1,4-benzodioxine-5-carboxylic acid, 95%, 8-chloro-2,3-dihydro-1,4-benzodioxine-5-carboxylic Acid. Offered by: AmBeed, TRC, Biosynth. Available pack sizes: 1g, 2,5mg, 25mg, 5mg, 50mg, 0,5g.
5-chloro-2,3-dihydro-1,4-benzodioxine-8-carboxylic acid (CAS 66411-24-3) is a chemical compound with the molecular formula C9H7ClO4 and a molecular weight of 214.60 g/mol. IUPAC name: 5-chloro-2,3-dihydro-1,4-benzodioxine-8-carboxylic acid. InChIKey: RHTLNBSAROMJMO-UHFFFAOYSA-N.
| Molecular formula | C9H7ClO4 |
|---|---|
| Molecular weight | 214.60 g/mol |
| IUPAC name | 5-chloro-2,3-dihydro-1,4-benzodioxine-8-carboxylic acid |
| InChIKey | RHTLNBSAROMJMO-UHFFFAOYSA-N |
| SMILES | C1COC2=C(C=CC(=C2O1)C(=O)O)Cl |
Computed by PubChem (NCBI)