CAS 66684-61-5 appears in our catalog under these names: 1,5–Difluoro–3–Methoxy–2–Nitro–Benzene, 1,5-Difluoro-3-methoxy-2-nitrobenzene 97%, 1,5-difluoro-3-methoxy-2-nitrobenzene, 97%, 97%, 4,6-DIFLUORO-2-METHOXYNITROBENZENE, 98%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 500g, 250mg, 1g, 10g, 100g, 50g.
1,5-difluoro-3-methoxy-2-nitrobenzene (CAS 66684-61-5) is a chemical compound with the molecular formula C7H5F2NO3 and a molecular weight of 189.12 g/mol. IUPAC name: 1,5-difluoro-3-methoxy-2-nitrobenzene. InChIKey: DXEGOHULGVHKCT-UHFFFAOYSA-N.
| Molecular formula | C7H5F2NO3 |
|---|---|
| Molecular weight | 189.12 g/mol |
| IUPAC name | 1,5-difluoro-3-methoxy-2-nitrobenzene |
| InChIKey | DXEGOHULGVHKCT-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=CC(=C1)F)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)