CAS 66751-98-2 is the registry number for Methyl 4-ethyl-a,g-dioxo-benzenebutanoate, 95%. Offered by: AmBeed. Available pack sizes: 5g.
Methyl 4-(4-ethylphenyl)-2,4-dioxobutanoate (CAS 66751-98-2) is a chemical compound with the molecular formula C13H14O4 and a molecular weight of 234.25 g/mol. IUPAC name: methyl 4-(4-ethylphenyl)-2,4-dioxobutanoate. InChIKey: JAZZWFIDDZXNSR-UHFFFAOYSA-N.
| Molecular formula | C13H14O4 |
|---|---|
| Molecular weight | 234.25 g/mol |
| IUPAC name | methyl 4-(4-ethylphenyl)-2,4-dioxobutanoate |
| InChIKey | JAZZWFIDDZXNSR-UHFFFAOYSA-N |
| SMILES | CCC1=CC=C(C=C1)C(=O)CC(=O)C(=O)OC |
Computed by PubChem (NCBI)