Products 67852-88-4
CAS 67852-88-4 appears in our catalog under these names: 10–(Benzyloxy)–10–oxodecanoic acid, 10-(Benzyloxy)-10-oxodecanoic acid, 97%, 97%, 10-(Benzyloxy)-10-oxodecanoic acid, 99.76%, 10-(Benzyloxy)-10-oxodecanoic acid, 97%. Offered by: GLPBio, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 250mg, 10g, 100mg, 1g, 5g, 500 mg, 5 g, 1 g.
10-oxo-10-phenylmethoxydecanoic acid (CAS 67852-88-4) is a chemical compound with the molecular formula C17H24O4 and a molecular weight of 292.4 g/mol. IUPAC name: 10-oxo-10-phenylmethoxydecanoic acid. InChIKey: RARFDGQRJGLQCZ-UHFFFAOYSA-N.
| Molecular formula | C17H24O4 |
|---|---|
| Molecular weight | 292.4 g/mol |
| IUPAC name | 10-oxo-10-phenylmethoxydecanoic acid |
| InChIKey | RARFDGQRJGLQCZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)CCCCCCCCC(=O)O |
Computed by PubChem (NCBI)