CAS 693285-60-8 is the registry number for 2,6-Dimethyl-3-methoxybenzene boronic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g, 100mg, 250mg.
(3-methoxy-2,6-dimethylphenyl)boronic acid (CAS 693285-60-8) is a chemical compound with the molecular formula C9H13BO3 and a molecular weight of 180.01 g/mol. IUPAC name: (3-methoxy-2,6-dimethylphenyl)boronic acid. InChIKey: COCNTHHHGVFXOS-UHFFFAOYSA-N.
| Molecular formula | C9H13BO3 |
|---|---|
| Molecular weight | 180.01 g/mol |
| IUPAC name | (3-methoxy-2,6-dimethylphenyl)boronic acid |
| InChIKey | COCNTHHHGVFXOS-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1C)OC)C)(O)O |
Computed by PubChem (NCBI)