CAS 695187-25-8 is the registry number for Methyl (E)-3-(3,5-dichlorophenyl)acrylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
Methyl (E)-3-(3,5-dichlorophenyl)prop-2-enoate (CAS 695187-25-8) is a chemical compound with the molecular formula C10H8Cl2O2 and a molecular weight of 231.07 g/mol. IUPAC name: methyl (E)-3-(3,5-dichlorophenyl)prop-2-enoate. InChIKey: DDUKGBAQKQLCDX-NSCUHMNNSA-N.
| Molecular formula | C10H8Cl2O2 |
|---|---|
| Molecular weight | 231.07 g/mol |
| IUPAC name | methyl (E)-3-(3,5-dichlorophenyl)prop-2-enoate |
| InChIKey | DDUKGBAQKQLCDX-NSCUHMNNSA-N |
| SMILES | COC(=O)/C=C/C1=CC(=CC(=C1)Cl)Cl |
Computed by PubChem (NCBI)