CAS 69603-99-2 is the registry number for ETHYL 6-NITROBENZOFURAN-2-CARBOXYLATE, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
Ethyl 6-nitro-1-benzofuran-2-carboxylate (CAS 69603-99-2) is a chemical compound with the molecular formula C11H9NO5 and a molecular weight of 235.19 g/mol. IUPAC name: ethyl 6-nitro-1-benzofuran-2-carboxylate. InChIKey: WQYQMTBJIBKNEP-UHFFFAOYSA-N.
| Molecular formula | C11H9NO5 |
|---|---|
| Molecular weight | 235.19 g/mol |
| IUPAC name | ethyl 6-nitro-1-benzofuran-2-carboxylate |
| InChIKey | WQYQMTBJIBKNEP-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=C(O1)C=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)