CAS 69844-34-4 is the registry number for 2-Chloro-3-((2-hydroxyethyl)amino)naphthalene-1,4-dione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-chloro-3-(2-hydroxyethylamino)naphthalene-1,4-dione (CAS 69844-34-4) is a chemical compound with the molecular formula C12H10ClNO3 and a molecular weight of 251.66 g/mol. IUPAC name: 2-chloro-3-(2-hydroxyethylamino)naphthalene-1,4-dione. InChIKey: MNAMDFQYYYJMKZ-UHFFFAOYSA-N.
| Molecular formula | C12H10ClNO3 |
|---|---|
| Molecular weight | 251.66 g/mol |
| IUPAC name | 2-chloro-3-(2-hydroxyethylamino)naphthalene-1,4-dione |
| InChIKey | MNAMDFQYYYJMKZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C(=C(C2=O)Cl)NCCO |
Computed by PubChem (NCBI)