CAS 69922-27-6 appears in our catalog under these names: 2-Fluoro-5-(trifluoromethyl)phenyl isocyanate, 97%, 2-Fluoro-5-(trifluoromethyl)phenyl isocyanate, 97% , 2-Fluoro-5-(trifluoromethyl)phenylisocyanate 97%, 2-FLUORO-5-(TRIFLUOROMETHYL)PHENYL. Offered by: Combi-blocks, Thermo Scientific (Alfa Aesar), Ambeed, Sigma-Aldrich, Fluorochem. Available pack sizes: 5g, 1g, 500g, 250mg, 25g, 100g, 2G.
1-fluoro-2-isocyanato-4-(trifluoromethyl)benzene (CAS 69922-27-6) is a chemical compound with the molecular formula C8H3F4NO and a molecular weight of 205.11 g/mol. IUPAC name: 1-fluoro-2-isocyanato-4-(trifluoromethyl)benzene. InChIKey: NAIKHCBDZGSGHH-UHFFFAOYSA-N.
| Molecular formula | C8H3F4NO |
|---|---|
| Molecular weight | 205.11 g/mol |
| IUPAC name | 1-fluoro-2-isocyanato-4-(trifluoromethyl)benzene |
| InChIKey | NAIKHCBDZGSGHH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)N=C=O)F |
Computed by PubChem (NCBI)