CAS 70891-37-1 is the registry number for Nafimidone (hydrochloride). Offered by: MedChemExpress. Available pack sizes: Get quote.
2-imidazol-1-yl-1-naphthalen-2-ylethanone;hydrochloride (CAS 70891-37-1) is a chemical compound with the molecular formula C15H13ClN2O and a molecular weight of 272.73 g/mol. IUPAC name: 2-imidazol-1-yl-1-naphthalen-2-ylethanone;hydrochloride. InChIKey: DOBNXXMVNHWJKU-UHFFFAOYSA-N.
| Molecular formula | C15H13ClN2O |
|---|---|
| Molecular weight | 272.73 g/mol |
| IUPAC name | 2-imidazol-1-yl-1-naphthalen-2-ylethanone;hydrochloride |
| InChIKey | DOBNXXMVNHWJKU-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C(C=CC2=C1)C(=O)CN3C=CN=C3.Cl |
Computed by PubChem (NCBI)