Products 709043-23-2

CAS 709043-23-2 is the registry number for Amino(3-methoxyphenyl)acetic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.

2-amino-2-(3-methoxyphenyl)acetic acid;hydrochloride (CAS 709043-23-2) is a chemical compound with the molecular formula C9H12ClNO3 and a molecular weight of 217.65 g/mol. IUPAC name: 2-amino-2-(3-methoxyphenyl)acetic acid;hydrochloride. InChIKey: PQGFWAYHLXGUED-UHFFFAOYSA-N.

Identity
Molecular formulaC9H12ClNO3
Molecular weight217.65 g/mol
IUPAC name2-amino-2-(3-methoxyphenyl)acetic acid;hydrochloride
InChIKeyPQGFWAYHLXGUED-UHFFFAOYSA-N
SMILESCOC1=CC=CC(=C1)C(C(=O)O)N.Cl

Computed by PubChem (NCBI)