Products 7099-91-4
CAS 7099-91-4 appears in our catalog under these names: (4-Methoxyphenyl)glyoxylic acid, 98%, 2-(4-Methoxyphenyl)-2-oxoacetic acid, 95%, 2-(4-Methoxyphenyl)-2-oxoacetic acid, 98%, 3-Hydroxy-1-p-tolylpropane-1,2-dione, 95%. Offered by: Fluorochem, Ambeed, Chemat, BLDpharm, Combi-blocks. Available pack sizes: 100mg, 250mg, 1g, 5g.
2-(4-methoxyphenyl)-2-oxoacetic acid (CAS 7099-91-4) is a chemical compound with the molecular formula C9H8O4 and a molecular weight of 180.16 g/mol. IUPAC name: 2-(4-methoxyphenyl)-2-oxoacetic acid. InChIKey: IDTFANFXLFNLMC-UHFFFAOYSA-N.
| Molecular formula | C9H8O4 |
|---|---|
| Molecular weight | 180.16 g/mol |
| IUPAC name | 2-(4-methoxyphenyl)-2-oxoacetic acid |
| InChIKey | IDTFANFXLFNLMC-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C(=O)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
2-(4-methoxyphenyl)-2-oxoacetic acid, (4-Methoxyphenyl)glyoxylic acid, 4-Methoxy-a-oxo-benzeneacetic acid, p-methoxybenzoylformic acid, (4-Methoxyphenyl)(oxo)acetic acid, p-methoxyphenylglyoxylic acid, 4-methoxybenzoyl formic acid, 4-methoxyphenylglyoxylic acid, (4-Methoxybenzoyl)formic acid, (4-methoxyphenyl)-oxoacetic acid