CAS 70995-08-3 appears in our catalog under these names: Nimesulide EP Impurity G, 4-Nitro-2-phenoxyphenol, >95% (HPLC), 4-Nitro-2-phenoxyphenol, Nimesulide impurity 7. Offered by: Chemat Brand, TRC, Mikromol, MedChemExpress. Available pack sizes: on request, 10mg, 25mg, Get quote.
4-nitro-2-phenoxyphenol (CAS 70995-08-3) is a chemical compound with the molecular formula C12H9NO4 and a molecular weight of 231.20 g/mol. IUPAC name: 4-nitro-2-phenoxyphenol. InChIKey: HWZCVJQSXDYRID-UHFFFAOYSA-N.
| Molecular formula | C12H9NO4 |
|---|---|
| Molecular weight | 231.20 g/mol |
| IUPAC name | 4-nitro-2-phenoxyphenol |
| InChIKey | HWZCVJQSXDYRID-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=C(C=CC(=C2)[N+](=O)[O-])O |
Computed by PubChem (NCBI)