Products 71295-28-8
CAS 71295-28-8 is the registry number for Crotananine. Offered by: Biosynth. Available pack sizes: 25mg, 10mg, 50mg.
(1R,17R)-7-hydroxy-4,5,6-trimethyl-2,9-dioxa-14-azatricyclo[9.5.1.014,17]heptadec-11-ene-3,8-dione (CAS 71295-28-8) is a chemical compound with the molecular formula C17H25NO5 and a molecular weight of 323.4 g/mol. IUPAC name: (1R,17R)-7-hydroxy-4,5,6-trimethyl-2,9-dioxa-14-azatricyclo[9.5.1.014,17]heptadec-11-ene-3,8-dione. InChIKey: GFXWTYYPYYHXDK-GLDVEYQJSA-N.
| Molecular formula | C17H25NO5 |
|---|---|
| Molecular weight | 323.4 g/mol |
| IUPAC name | (1R,17R)-7-hydroxy-4,5,6-trimethyl-2,9-dioxa-14-azatricyclo[9.5.1.014,17]heptadec-11-ene-3,8-dione |
| InChIKey | GFXWTYYPYYHXDK-GLDVEYQJSA-N |
| SMILES | CC1C(C(C(=O)OCC2=CCN3[C@H]2[C@@H](CC3)OC(=O)C1C)O)C |
Computed by PubChem (NCBI)