CAS 71435-39-7 appears in our catalog under these names: 7-Phenyl-3H,4H,5H-pyrrolo(3,2-d)pyrimidin-4-one, 95%, 7-Phenyl-3H,4H,5H-pyrrolo(3,2-d)pyrimidin-4-one. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
7-phenyl-3,5-dihydropyrrolo[3,2-d]pyrimidin-4-one (CAS 71435-39-7) is a chemical compound with the molecular formula C12H9N3O and a molecular weight of 211.22 g/mol. IUPAC name: 7-phenyl-3,5-dihydropyrrolo[3,2-d]pyrimidin-4-one. InChIKey: FRFOBNOUFSXEHO-UHFFFAOYSA-N.
| Molecular formula | C12H9N3O |
|---|---|
| Molecular weight | 211.22 g/mol |
| IUPAC name | 7-phenyl-3,5-dihydropyrrolo[3,2-d]pyrimidin-4-one |
| InChIKey | FRFOBNOUFSXEHO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CNC3=C2N=CNC3=O |
Computed by PubChem (NCBI)