CAS 7147-90-2 appears in our catalog under these names: 5–Chloroisoindoline–1,3–dione, 5-Chloroisoindoline-1,3-dione 98%, 5-Chloroisoindoline-1,3-dione, 98%, 98%, 5-Chloroisoindoline-1,3-dione, 98%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 1g, 5g, 100mg, 250mg, 25g.
5-chloroisoindole-1,3-dione (CAS 7147-90-2) is a chemical compound with the molecular formula C8H4ClNO2 and a molecular weight of 181.57 g/mol. IUPAC name: 5-chloroisoindole-1,3-dione. InChIKey: BGJNRQSGJHVURK-UHFFFAOYSA-N.
| Molecular formula | C8H4ClNO2 |
|---|---|
| Molecular weight | 181.57 g/mol |
| IUPAC name | 5-chloroisoindole-1,3-dione |
| InChIKey | BGJNRQSGJHVURK-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)C(=O)NC2=O |
Computed by PubChem (NCBI)