Products 71568-87-1
CAS 71568-87-1 appears in our catalog under these names: 2–Bromo–3，4–dimethoxybenzoic acid, 2-Bromo-3,4-dimethoxybenzoic acid, 2-Bromo-3,4-dimethoxybenzoic acid 97%, Benzoic acid, 2-bromo-3,4-dimethoxy-, 97%, 97%, 2-Bromo-3,4-dimethoxybenzoic acid, 98%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 0,5g, 50mg, 250mg, 1g, 5g.
2-bromo-3,4-dimethoxybenzoic acid (CAS 71568-87-1) is a chemical compound with the molecular formula C9H9BrO4 and a molecular weight of 261.07 g/mol. IUPAC name: 2-bromo-3,4-dimethoxybenzoic acid. InChIKey: FAJWLJIACRMYSO-UHFFFAOYSA-N.
| Molecular formula | C9H9BrO4 |
|---|---|
| Molecular weight | 261.07 g/mol |
| IUPAC name | 2-bromo-3,4-dimethoxybenzoic acid |
| InChIKey | FAJWLJIACRMYSO-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1)C(=O)O)Br)OC |
Computed by PubChem (NCBI)