CAS 7170-68-5 is the registry number for 3-(2,5-Dichlorophenoxy)propanoic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.
3-(2,5-dichlorophenoxy)propanoic acid (CAS 7170-68-5) is a chemical compound with the molecular formula C9H8Cl2O3 and a molecular weight of 235.06 g/mol. IUPAC name: 3-(2,5-dichlorophenoxy)propanoic acid. InChIKey: IOPJZIQVDBFLAJ-UHFFFAOYSA-N.
| Molecular formula | C9H8Cl2O3 |
|---|---|
| Molecular weight | 235.06 g/mol |
| IUPAC name | 3-(2,5-dichlorophenoxy)propanoic acid |
| InChIKey | IOPJZIQVDBFLAJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)OCCC(=O)O)Cl |
Computed by PubChem (NCBI)