Products 7170-68-5

CAS 7170-68-5 is the registry number for 3-(2,5-Dichlorophenoxy)propanoic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.

Structural formula: {0} (CAS {1})

3-(2,5-dichlorophenoxy)propanoic acid (CAS 7170-68-5) is a chemical compound with the molecular formula C9H8Cl2O3 and a molecular weight of 235.06 g/mol. IUPAC name: 3-(2,5-dichlorophenoxy)propanoic acid. InChIKey: IOPJZIQVDBFLAJ-UHFFFAOYSA-N.

Identity
Molecular formulaC9H8Cl2O3
Molecular weight235.06 g/mol
IUPAC name3-(2,5-dichlorophenoxy)propanoic acid
InChIKeyIOPJZIQVDBFLAJ-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1Cl)OCCC(=O)O)Cl

Computed by PubChem (NCBI)