CAS 71953-72-5 is the registry number for Metahexestrol. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-[(3S,4R)-4-(3-hydroxyphenyl)hexan-3-yl]phenol (CAS 71953-72-5) is a chemical compound with the molecular formula C18H22O2 and a molecular weight of 270.4 g/mol. IUPAC name: 3-[(3S,4R)-4-(3-hydroxyphenyl)hexan-3-yl]phenol. InChIKey: KUJAWCSIKNKXLL-HDICACEKSA-N.
| Molecular formula | C18H22O2 |
|---|---|
| Molecular weight | 270.4 g/mol |
| IUPAC name | 3-[(3S,4R)-4-(3-hydroxyphenyl)hexan-3-yl]phenol |
| InChIKey | KUJAWCSIKNKXLL-HDICACEKSA-N |
| SMILES | CC[C@H](C1=CC(=CC=C1)O)[C@@H](CC)C2=CC(=CC=C2)O |
Computed by PubChem (NCBI)