CAS 720-94-5 appears in our catalog under these names: Celecoxib Impurity 30, 1-(4-Methylphenyl)-4,4,4-trifluorobutane-1,3-dione, >95% (HPLC), 1-(4-Methylphenyl)-4,4,4-trifluorobutane-1,3-dione, 4,4,4–Trifluoro–1–(p–tolyl)–1,3–butanedione, 4,4,4-Trifluoro-1-(p-tolyl)-1,3-butanedione, >98.0%(GC). Offered by: Chemat Brand, TRC, Mikromol, GLPBio, TCI. Available pack sizes: on request, 1g, 5g, 25mg, 100g, 25g, 500g, 1kg.
4,4,4-trifluoro-1-(4-methylphenyl)butane-1,3-dione (CAS 720-94-5) is a chemical compound with the molecular formula C11H9F3O2 and a molecular weight of 230.18 g/mol. IUPAC name: 4,4,4-trifluoro-1-(4-methylphenyl)butane-1,3-dione. InChIKey: WRZMHTIRFOFFPY-UHFFFAOYSA-N.
| Molecular formula | C11H9F3O2 |
|---|---|
| Molecular weight | 230.18 g/mol |
| IUPAC name | 4,4,4-trifluoro-1-(4-methylphenyl)butane-1,3-dione |
| InChIKey | WRZMHTIRFOFFPY-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C(=O)CC(=O)C(F)(F)F |
Computed by PubChem (NCBI)