Products 721939-61-3
CAS 721939-61-3 appears in our catalog under these names: 2-(4-((Fmoc-amino)methyl)phenoxy)acetic acid, 2-[4-[(Fmoc-amino)methyl]phenoxy]acetic acid, 98%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 0,5g, 50mg, 100mg, 250mg, 500mg, 1g.
2-[4-[(9H-fluoren-9-ylmethoxycarbonylamino)methyl]phenoxy]acetic acid (CAS 721939-61-3) is a chemical compound with the molecular formula C24H21NO5 and a molecular weight of 403.4 g/mol. IUPAC name: 2-[4-[(9H-fluoren-9-ylmethoxycarbonylamino)methyl]phenoxy]acetic acid. InChIKey: UMEWMJIMNNHEBO-UHFFFAOYSA-N.
| Molecular formula | C24H21NO5 |
|---|---|
| Molecular weight | 403.4 g/mol |
| IUPAC name | 2-[4-[(9H-fluoren-9-ylmethoxycarbonylamino)methyl]phenoxy]acetic acid |
| InChIKey | UMEWMJIMNNHEBO-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NCC4=CC=C(C=C4)OCC(=O)O |
Computed by PubChem (NCBI)