CAS 72299-96-8 appears in our catalog under these names: 1,3-Dioxoisoindolin-2-yl methacrylate, 98%, 1,3-Dioxoisoindolin-2-yl Methacrylate, >98.0%(GC), 1H-Isoindole-1,3(2H)-dione, 2-[(2-methyl-1-oxo-2-propenyl)oxy]-, 98.0%, 98.0%. Offered by: Chemat Brand, TCI, Chemat. Available pack sizes: on request, 1g, 5g.
(1,3-dioxoisoindol-2-yl) 2-methylprop-2-enoate (CAS 72299-96-8) is a chemical compound with the molecular formula C12H9NO4 and a molecular weight of 231.20 g/mol. IUPAC name: (1,3-dioxoisoindol-2-yl) 2-methylprop-2-enoate. InChIKey: QKTOEXNMNPTDSF-UHFFFAOYSA-N.
| Molecular formula | C12H9NO4 |
|---|---|
| Molecular weight | 231.20 g/mol |
| IUPAC name | (1,3-dioxoisoindol-2-yl) 2-methylprop-2-enoate |
| InChIKey | QKTOEXNMNPTDSF-UHFFFAOYSA-N |
| SMILES | CC(=C)C(=O)ON1C(=O)C2=CC=CC=C2C1=O |
Computed by PubChem (NCBI)