CAS 73219-89-3 appears in our catalog under these names: 3-Bromo-2,6-dimethoxybenzoic acid, 3-Bromo-2,6-dimethoxybenzoic acid, 97+% , 3-Bromo-2,6-dimethoxybenzoic acid 95%, 3-Bromo-2,6-dimethoxybenzoic acid, 95%, 95%. Offered by: Biosynth, Thermo Scientific, Ambeed, Chemat. Available pack sizes: 25g, 1g, 10g, 5g.
3-bromo-2,6-dimethoxybenzoic acid (CAS 73219-89-3) is a chemical compound with the molecular formula C9H9BrO4 and a molecular weight of 261.07 g/mol. IUPAC name: 3-bromo-2,6-dimethoxybenzoic acid. InChIKey: CUQANLQRQJHIQE-UHFFFAOYSA-N.
| Molecular formula | C9H9BrO4 |
|---|---|
| Molecular weight | 261.07 g/mol |
| IUPAC name | 3-bromo-2,6-dimethoxybenzoic acid |
| InChIKey | CUQANLQRQJHIQE-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1)Br)OC)C(=O)O |
Computed by PubChem (NCBI)