CAS 73282-11-8 is the registry number for [1-(Phenylsulfonyl)-1H-indol-2-yl]methanol, 97% . Offered by: Thermo Scientific. Available pack sizes: 250MG, 1g.
[1-(benzenesulfonyl)indol-2-yl]methanol (CAS 73282-11-8) is a chemical compound with the molecular formula C15H13NO3S and a molecular weight of 287.3 g/mol. IUPAC name: [1-(benzenesulfonyl)indol-2-yl]methanol. InChIKey: LRYLVFIUTJMZBY-UHFFFAOYSA-N.
| Molecular formula | C15H13NO3S |
|---|---|
| Molecular weight | 287.3 g/mol |
| IUPAC name | [1-(benzenesulfonyl)indol-2-yl]methanol |
| InChIKey | LRYLVFIUTJMZBY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)S(=O)(=O)N2C3=CC=CC=C3C=C2CO |
Computed by PubChem (NCBI)