CAS 73557-64-9 appears in our catalog under these names: 2,3-Dibromo-5-nitrotoluene, 95+%, 2,3-Dibromo-5-nitrotoluene, 95%. Offered by: AmBeed, Fluorochem. Available pack sizes: 5g, 1g.
1,2-dibromo-3-methyl-5-nitrobenzene (CAS 73557-64-9) is a chemical compound with the molecular formula C7H5Br2NO2 and a molecular weight of 294.93 g/mol. IUPAC name: 1,2-dibromo-3-methyl-5-nitrobenzene. InChIKey: UBMOZBCSMJIDTD-UHFFFAOYSA-N.
| Molecular formula | C7H5Br2NO2 |
|---|---|
| Molecular weight | 294.93 g/mol |
| IUPAC name | 1,2-dibromo-3-methyl-5-nitrobenzene |
| InChIKey | UBMOZBCSMJIDTD-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1Br)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)