Products 73775-26-5
CAS 73775-26-5 appears in our catalog under these names: 2-(5-Methylthien-2-yl)quinoline-4-carboxylic acid, 95%, 2-(5-Methylthiophen-2-yl)quinoline-4-carboxylic acid, 97%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 1g, 5g, 250mg.
2-(5-methylthiophen-2-yl)quinoline-4-carboxylic acid (CAS 73775-26-5) is a chemical compound with the molecular formula C15H11NO2S and a molecular weight of 269.3 g/mol. IUPAC name: 2-(5-methylthiophen-2-yl)quinoline-4-carboxylic acid. InChIKey: SMFDPIVZZGFOPD-UHFFFAOYSA-N.
| Molecular formula | C15H11NO2S |
|---|---|
| Molecular weight | 269.3 g/mol |
| IUPAC name | 2-(5-methylthiophen-2-yl)quinoline-4-carboxylic acid |
| InChIKey | SMFDPIVZZGFOPD-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(S1)C2=NC3=CC=CC=C3C(=C2)C(=O)O |
Computed by PubChem (NCBI)