CAS 25108-21-8 appears in our catalog under these names: 2-(1,3-Benzothiazol-2-ylmethyl)benzoic acid, 95%, 2-(Benzo(d)thiazol-2-ylmethyl)benzoic acid, 97%, 2-(1,3-Benzothiazol-2-ylmethyl)benzoic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 250mg, 100mg, 5g, 10g, 2,5g.
2-(1,3-benzothiazol-2-ylmethyl)benzoic acid (CAS 25108-21-8) is a chemical compound with the molecular formula C15H11NO2S and a molecular weight of 269.3 g/mol. IUPAC name: 2-(1,3-benzothiazol-2-ylmethyl)benzoic acid. InChIKey: GUGMOJJRLDQPQR-UHFFFAOYSA-N.
| Molecular formula | C15H11NO2S |
|---|---|
| Molecular weight | 269.3 g/mol |
| IUPAC name | 2-(1,3-benzothiazol-2-ylmethyl)benzoic acid |
| InChIKey | GUGMOJJRLDQPQR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CC2=NC3=CC=CC=C3S2)C(=O)O |
Computed by PubChem (NCBI)