CAS 1160264-28-7 is the registry number for 3-Phenyl-2h-1,4-benzothiazine-2-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
3-phenyl-2H-1,4-benzothiazine-2-carboxylic acid (CAS 1160264-28-7) is a chemical compound with the molecular formula C15H11NO2S and a molecular weight of 269.3 g/mol. IUPAC name: 3-phenyl-2H-1,4-benzothiazine-2-carboxylic acid. InChIKey: WIFDWIFDEAHTNP-UHFFFAOYSA-N.
| Molecular formula | C15H11NO2S |
|---|---|
| Molecular weight | 269.3 g/mol |
| IUPAC name | 3-phenyl-2H-1,4-benzothiazine-2-carboxylic acid |
| InChIKey | WIFDWIFDEAHTNP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC3=CC=CC=C3SC2C(=O)O |
Computed by PubChem (NCBI)