Products 1160264-28-7

CAS 1160264-28-7 is the registry number for 3-Phenyl-2h-1,4-benzothiazine-2-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

3-phenyl-2H-1,4-benzothiazine-2-carboxylic acid (CAS 1160264-28-7) is a chemical compound with the molecular formula C15H11NO2S and a molecular weight of 269.3 g/mol. IUPAC name: 3-phenyl-2H-1,4-benzothiazine-2-carboxylic acid. InChIKey: WIFDWIFDEAHTNP-UHFFFAOYSA-N.

Identity
Molecular formulaC15H11NO2S
Molecular weight269.3 g/mol
IUPAC name3-phenyl-2H-1,4-benzothiazine-2-carboxylic acid
InChIKeyWIFDWIFDEAHTNP-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)C2=NC3=CC=CC=C3SC2C(=O)O

Computed by PubChem (NCBI)