CAS 31123-52-1 appears in our catalog under these names: 10–Methyl–10H–phenothiazine–3,7–dicarbaldehyde, 10-Methyl-10H-phenothiazine-3,7-dicarbaldehyde, 98%, 98%, 10-Methyl-10H-phenothiazine-3,7-dicarbaldehyde, 98%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 50mg, 100mg, 250mg, 1g.
10-methylphenothiazine-3,7-dicarbaldehyde (CAS 31123-52-1) is a chemical compound with the molecular formula C15H11NO2S and a molecular weight of 269.3 g/mol. IUPAC name: 10-methylphenothiazine-3,7-dicarbaldehyde. InChIKey: FCHUFBLISOGXHO-UHFFFAOYSA-N.
| Molecular formula | C15H11NO2S |
|---|---|
| Molecular weight | 269.3 g/mol |
| IUPAC name | 10-methylphenothiazine-3,7-dicarbaldehyde |
| InChIKey | FCHUFBLISOGXHO-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=C(C=C2)C=O)SC3=C1C=CC(=C3)C=O |
Computed by PubChem (NCBI)