CAS 23353-15-3 appears in our catalog under these names: 2-(2-(Naphthalen-1-yl)-1,3-thiazol-4-yl)acetic acid, 95%, 2-(2-(Naphthalen-1-yl)-1,3-thiazol-4-yl)acetic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
2-(2-naphthalen-1-yl-1,3-thiazol-4-yl)acetic acid (CAS 23353-15-3) is a chemical compound with the molecular formula C15H11NO2S and a molecular weight of 269.3 g/mol. IUPAC name: 2-(2-naphthalen-1-yl-1,3-thiazol-4-yl)acetic acid. InChIKey: LVBIDCYDHPYFJZ-UHFFFAOYSA-N.
| Molecular formula | C15H11NO2S |
|---|---|
| Molecular weight | 269.3 g/mol |
| IUPAC name | 2-(2-naphthalen-1-yl-1,3-thiazol-4-yl)acetic acid |
| InChIKey | LVBIDCYDHPYFJZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC=C2C3=NC(=CS3)CC(=O)O |
Computed by PubChem (NCBI)