CAS 1146290-06-3 is the registry number for 6-(Benzylsulfanyl)-2,3-dihydro-1H-indole-2,3-dione. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
6-benzylsulfanyl-1H-indole-2,3-dione (CAS 1146290-06-3) is a chemical compound with the molecular formula C15H11NO2S and a molecular weight of 269.3 g/mol. IUPAC name: 6-benzylsulfanyl-1H-indole-2,3-dione. InChIKey: SGZOWXNTVRZUQE-UHFFFAOYSA-N.
| Molecular formula | C15H11NO2S |
|---|---|
| Molecular weight | 269.3 g/mol |
| IUPAC name | 6-benzylsulfanyl-1H-indole-2,3-dione |
| InChIKey | SGZOWXNTVRZUQE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CSC2=CC3=C(C=C2)C(=O)C(=O)N3 |
Computed by PubChem (NCBI)