CAS 14204-26-3 appears in our catalog under these names: 2-(Benzylsulfanyl)-2,3-dihydro-1h-isoindole-1,3-dione, 95%, 2-(Benzylthio)isoindoline-1,3-dione, 97%, 2-(Benzylsulfanyl)-2,3-dihydro-1H-isoindole-1,3-dione. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg, 2,5g.
2-benzylsulfanylisoindole-1,3-dione (CAS 14204-26-3) is a chemical compound with the molecular formula C15H11NO2S and a molecular weight of 269.3 g/mol. IUPAC name: 2-benzylsulfanylisoindole-1,3-dione. InChIKey: XOAUPDRAKPXFQO-UHFFFAOYSA-N.
| Molecular formula | C15H11NO2S |
|---|---|
| Molecular weight | 269.3 g/mol |
| IUPAC name | 2-benzylsulfanylisoindole-1,3-dione |
| InChIKey | XOAUPDRAKPXFQO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CSN2C(=O)C3=CC=CC=C3C2=O |
Computed by PubChem (NCBI)