CAS 1550316-77-2 is the registry number for Methyl 2-(naphthalen-1-yl)thiazole-4-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 2-naphthalen-1-yl-1,3-thiazole-4-carboxylate (CAS 1550316-77-2) is a chemical compound with the molecular formula C15H11NO2S and a molecular weight of 269.3 g/mol. IUPAC name: methyl 2-naphthalen-1-yl-1,3-thiazole-4-carboxylate. InChIKey: IDHNJWDAFZGPBL-UHFFFAOYSA-N.
| Molecular formula | C15H11NO2S |
|---|---|
| Molecular weight | 269.3 g/mol |
| IUPAC name | methyl 2-naphthalen-1-yl-1,3-thiazole-4-carboxylate |
| InChIKey | IDHNJWDAFZGPBL-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CSC(=N1)C2=CC=CC3=CC=CC=C32 |
Computed by PubChem (NCBI)