Products 74057-36-6
CAS 74057-36-6 is the registry number for Naphthalene-1,2-dicarbaldehyde. Offered by: MedChemExpress. Available pack sizes: Get quote.
Naphthalene-1,2-dicarbaldehyde (CAS 74057-36-6) is a chemical compound with the molecular formula C12H8O2 and a molecular weight of 184.19 g/mol. IUPAC name: naphthalene-1,2-dicarbaldehyde. InChIKey: WMPJPAMWRAOQSU-UHFFFAOYSA-N.
| Molecular formula | C12H8O2 |
|---|---|
| Molecular weight | 184.19 g/mol |
| IUPAC name | naphthalene-1,2-dicarbaldehyde |
| InChIKey | WMPJPAMWRAOQSU-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC(=C2C=O)C=O |
Computed by PubChem (NCBI)