CAS 74386-55-3 appears in our catalog under these names: 5-(Benzyloxy)pyridine-2-carboxylic acid, 5-(Benzyloxy)pyridine-2-carboxylic acid, 98%, 98%, 5-(Benzyloxy)pyridine-2-carboxylic acid, 98%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 50mg, 0,5g, 100mg, 250mg, 1g, 500mg, 2.5g.
5-phenylmethoxypyridine-2-carboxylic acid (CAS 74386-55-3) is a chemical compound with the molecular formula C13H11NO3 and a molecular weight of 229.23 g/mol. IUPAC name: 5-phenylmethoxypyridine-2-carboxylic acid. InChIKey: FQSOASDQLNSXJQ-UHFFFAOYSA-N.
| Molecular formula | C13H11NO3 |
|---|---|
| Molecular weight | 229.23 g/mol |
| IUPAC name | 5-phenylmethoxypyridine-2-carboxylic acid |
| InChIKey | FQSOASDQLNSXJQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CN=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)