CAS 749268-53-9 is the registry number for 2-Methoxy-3,5-dimethylbenzene-1-sulfonyl chloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-methoxy-3,5-dimethylbenzenesulfonyl chloride (CAS 749268-53-9) is a chemical compound with the molecular formula C9H11ClO3S and a molecular weight of 234.70 g/mol. IUPAC name: 2-methoxy-3,5-dimethylbenzenesulfonyl chloride. InChIKey: CRGHFEWSHJGVJX-UHFFFAOYSA-N.
| Molecular formula | C9H11ClO3S |
|---|---|
| Molecular weight | 234.70 g/mol |
| IUPAC name | 2-methoxy-3,5-dimethylbenzenesulfonyl chloride |
| InChIKey | CRGHFEWSHJGVJX-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)S(=O)(=O)Cl)OC)C |
Computed by PubChem (NCBI)