CAS 753009-59-5 appears in our catalog under these names: 2-Benzyl-4-nitrophenol, 95%, 2-Benzyl-4-nitrophenol. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.
2-benzyl-4-nitrophenol (CAS 753009-59-5) is a chemical compound with the molecular formula C13H11NO3 and a molecular weight of 229.23 g/mol. IUPAC name: 2-benzyl-4-nitrophenol. InChIKey: LPZJACDNYUKILW-UHFFFAOYSA-N.
| Molecular formula | C13H11NO3 |
|---|---|
| Molecular weight | 229.23 g/mol |
| IUPAC name | 2-benzyl-4-nitrophenol |
| InChIKey | LPZJACDNYUKILW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC2=C(C=CC(=C2)[N+](=O)[O-])O |
Computed by PubChem (NCBI)